About 2-[(3,4-dimethylphenyl)methyl]-6-hydroxy-4H-1,4-benzoxazin-3-one
2-[(3,4-dimethylphenyl)methyl]-6-hydroxy-4H-1,4-benzoxazin-3-one (PubChem CID 82228709) has the molecular formula C17H17NO3
and a molecular weight of 283.33 g/mol. Its IUPAC name is 2-[(3,4-dimethylphenyl)methyl]-6-hydroxy-4H-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 2-[(3,4-dimethylphenyl)methyl]-6-hydroxy-4H-1,4-benzoxazin-3-one |
| PubChem CID | 82228709 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 2-[(3,4-dimethylphenyl)methyl]-6-hydroxy-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1ccc(CC2Oc3ccc(O)cc3NC2=O)cc1C |
| InChI | InChI=1S/C17H17NO3/c1-10-3-4-12(7-11(10)2)8-16-17(20)18-14-9-13(19)5-6-15(14)21-16/h3-7,9,16,19H,8H2,1-2H3,(H,18,20) |
| InChIKey | MRLRLUSSIBSGLA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(3,4-dimethylphenyl)methyl]-6-hydroxy-4H-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,4-dimethylphenyl)methyl]-6-hydroxy-4H-1,4-benzoxazin-3-one?
The IUPAC name of 2-[(3,4-dimethylphenyl)methyl]-6-hydroxy-4H-1,4-benzoxazin-3-one (CID 82228709) is 2-[(3,4-dimethylphenyl)methyl]-6-hydroxy-4H-1,4-benzoxazin-3-one.
What is the SMILES notation for 2-[(3,4-dimethylphenyl)methyl]-6-hydroxy-4H-1,4-benzoxazin-3-one?
The canonical SMILES for 2-[(3,4-dimethylphenyl)methyl]-6-hydroxy-4H-1,4-benzoxazin-3-one is Cc1ccc(CC2Oc3ccc(O)cc3NC2=O)cc1C.
What is the InChIKey of 2-[(3,4-dimethylphenyl)methyl]-6-hydroxy-4H-1,4-benzoxazin-3-one?
The InChIKey is MRLRLUSSIBSGLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO3/c1-10-3-4-12(7-11(10)2)8-16-17(20)18-14-9-13(19)5-6-15(14)21-16/h3-7,9,16,19H,8H2,1-2H3,(H,18,20).
What are the key properties of 2-[(3,4-dimethylphenyl)methyl]-6-hydroxy-4H-1,4-benzoxazin-3-one?
2-[(3,4-dimethylphenyl)methyl]-6-hydroxy-4H-1,4-benzoxazin-3-one has a molecular weight of 283.33 g/mol, XLogP of 2.95, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,4-dimethylphenyl)methyl]-6-hydroxy-4H-1,4-benzoxazin-3-one is sourced from PubChem (CID 82228709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).