C17H19NO2 — CID 82228774
2-[(2,5-dimethylphenyl)methyl]-3,4-dihydro-2H-1,4-benzoxazin-7-ol (PubChem CID 82228774) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 2-[(2,5-dimethylphenyl)methyl]-3,4-dihydro-2H-1,4-benzoxazin-7-ol.
| Compound Name | 2-[(2,5-dimethylphenyl)methyl]-3,4-dihydro-2H-1,4-benzoxazin-7-ol |
|---|---|
| PubChem CID | 82228774 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-[(2,5-dimethylphenyl)methyl]-3,4-dihydro-2H-1,4-benzoxazin-7-ol |
| SMILES | Cc1ccc(C)c(CC2CNc3ccc(O)cc3O2)c1 |
| InChI | InChI=1S/C17H19NO2/c1-11-3-4-12(2)13(7-11)8-15-10-18-16-6-5-14(19)9-17(16)20-15/h3-7,9,15,18-19H,8,10H2,1-2H3 |
| InChIKey | OXJRTRYZMHEHEG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|