C19H22N2O3 — CID 82229315
6-amino-2-[(3,4-dimethylphenyl)methyl]-4-(2-hydroxyethyl)-1,4-benzoxazin-3-one (PubChem CID 82229315) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is 6-amino-2-[(3,4-dimethylphenyl)methyl]-4-(2-hydroxyethyl)-1,4-benzoxazin-3-one.
| Compound Name | 6-amino-2-[(3,4-dimethylphenyl)methyl]-4-(2-hydroxyethyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82229315 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 6-amino-2-[(3,4-dimethylphenyl)methyl]-4-(2-hydroxyethyl)-1,4-benzoxazin-3-one |
| SMILES | Cc1ccc(CC2Oc3ccc(N)cc3N(CCO)C2=O)cc1C |
| InChI | InChI=1S/C19H22N2O3/c1-12-3-4-14(9-13(12)2)10-18-19(23)21(7-8-22)16-11-15(20)5-6-17(16)24-18/h3-6,9,11,18,22H,7-8,10,20H2,1-2H3 |
| InChIKey | XGCNBFUJZLORAF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|