About 4,7-dimethyl-1,3-benzoxazol-5-amine
4,7-dimethyl-1,3-benzoxazol-5-amine (PubChem CID 82229632) has the molecular formula C9H10N2O
and a molecular weight of 162.19 g/mol. Its IUPAC name is 4,7-dimethyl-1,3-benzoxazol-5-amine.
Molecular Properties
| Compound Name | 4,7-dimethyl-1,3-benzoxazol-5-amine |
| PubChem CID | 82229632 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 4,7-dimethyl-1,3-benzoxazol-5-amine |
| SMILES | Cc1c(N)cc(C)c2ocnc12 |
| InChI | InChI=1S/C9H10N2O/c1-5-3-7(10)6(2)8-9(5)12-4-11-8/h3-4H,10H2,1-2H3 |
| InChIKey | UYKFOKGEEBXQLX-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4,7-dimethyl-1,3-benzoxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dimethyl-1,3-benzoxazol-5-amine?
The IUPAC name of 4,7-dimethyl-1,3-benzoxazol-5-amine (CID 82229632) is 4,7-dimethyl-1,3-benzoxazol-5-amine.
What is the SMILES notation for 4,7-dimethyl-1,3-benzoxazol-5-amine?
The canonical SMILES for 4,7-dimethyl-1,3-benzoxazol-5-amine is Cc1c(N)cc(C)c2ocnc12.
What is the InChIKey of 4,7-dimethyl-1,3-benzoxazol-5-amine?
The InChIKey is UYKFOKGEEBXQLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O/c1-5-3-7(10)6(2)8-9(5)12-4-11-8/h3-4H,10H2,1-2H3.
What are the key properties of 4,7-dimethyl-1,3-benzoxazol-5-amine?
4,7-dimethyl-1,3-benzoxazol-5-amine has a molecular weight of 162.19 g/mol, XLogP of 2.03, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dimethyl-1,3-benzoxazol-5-amine is sourced from PubChem (CID 82229632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).