About 8-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazine
8-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazine (PubChem CID 82229656) has the molecular formula C9H10FNO
and a molecular weight of 167.18 g/mol. Its IUPAC name is 8-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazine.
Molecular Properties
| Compound Name | 8-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazine |
| PubChem CID | 82229656 |
| Molecular Formula | C9H10FNO |
| Molecular Weight | 167.18 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 8-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazine |
| SMILES | CN1CCOc2c(F)cccc21 |
| InChI | InChI=1S/C9H10FNO/c1-11-5-6-12-9-7(10)3-2-4-8(9)11/h2-4H,5-6H2,1H3 |
| InChIKey | PMARPCBVQJWVKY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.18 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazine?
The IUPAC name of 8-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazine (CID 82229656) is 8-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazine.
What is the SMILES notation for 8-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazine?
The canonical SMILES for 8-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazine is CN1CCOc2c(F)cccc21.
What is the InChIKey of 8-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazine?
The InChIKey is PMARPCBVQJWVKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FNO/c1-11-5-6-12-9-7(10)3-2-4-8(9)11/h2-4H,5-6H2,1H3.
What are the key properties of 8-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazine?
8-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazine has a molecular weight of 167.18 g/mol, XLogP of 1.65, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazine is sourced from PubChem (CID 82229656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).