About (7-ethyl-1,3-benzoxazol-2-yl)methanamine
(7-ethyl-1,3-benzoxazol-2-yl)methanamine (PubChem CID 82229700) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is (7-ethyl-1,3-benzoxazol-2-yl)methanamine.
Molecular Properties
| Compound Name | (7-ethyl-1,3-benzoxazol-2-yl)methanamine |
| PubChem CID | 82229700 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | (7-ethyl-1,3-benzoxazol-2-yl)methanamine |
| SMILES | CCc1cccc2nc(CN)oc12 |
| InChI | InChI=1S/C10H12N2O/c1-2-7-4-3-5-8-10(7)13-9(6-11)12-8/h3-5H,2,6,11H2,1H3 |
| InChIKey | IOVGVZIIMUAWOS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (7-ethyl-1,3-benzoxazol-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-ethyl-1,3-benzoxazol-2-yl)methanamine?
The IUPAC name of (7-ethyl-1,3-benzoxazol-2-yl)methanamine (CID 82229700) is (7-ethyl-1,3-benzoxazol-2-yl)methanamine.
What is the SMILES notation for (7-ethyl-1,3-benzoxazol-2-yl)methanamine?
The canonical SMILES for (7-ethyl-1,3-benzoxazol-2-yl)methanamine is CCc1cccc2nc(CN)oc12.
What is the InChIKey of (7-ethyl-1,3-benzoxazol-2-yl)methanamine?
The InChIKey is IOVGVZIIMUAWOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O/c1-2-7-4-3-5-8-10(7)13-9(6-11)12-8/h3-5H,2,6,11H2,1H3.
What are the key properties of (7-ethyl-1,3-benzoxazol-2-yl)methanamine?
(7-ethyl-1,3-benzoxazol-2-yl)methanamine has a molecular weight of 176.22 g/mol, XLogP of 1.85, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7-ethyl-1,3-benzoxazol-2-yl)methanamine is sourced from PubChem (CID 82229700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).