C11H14N2O — CID 82229881
2,4,5,7-tetramethyl-1,3-benzoxazol-6-amine (PubChem CID 82229881) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 2,4,5,7-tetramethyl-1,3-benzoxazol-6-amine.
| Compound Name | 2,4,5,7-tetramethyl-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 82229881 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 2,4,5,7-tetramethyl-1,3-benzoxazol-6-amine |
| SMILES | Cc1nc2c(C)c(C)c(N)c(C)c2o1 |
| InChI | InChI=1S/C11H14N2O/c1-5-6(2)10-11(7(3)9(5)12)14-8(4)13-10/h12H2,1-4H3 |
| InChIKey | GCZBQHCNASEOAP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|