C12H17NO — CID 82229951
3-ethyl-6,8-dimethyl-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 82229951) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 3-ethyl-6,8-dimethyl-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | 3-ethyl-6,8-dimethyl-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 82229951 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 3-ethyl-6,8-dimethyl-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | CCC1COc2c(C)cc(C)cc2N1 |
| InChI | InChI=1S/C12H17NO/c1-4-10-7-14-12-9(3)5-8(2)6-11(12)13-10/h5-6,10,13H,4,7H2,1-3H3 |
| InChIKey | IGXYBSUKXGTCMT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |