About 6,7,9-trimethyl-2,3,4,5-tetrahydro-1,5-benzoxazepine
6,7,9-trimethyl-2,3,4,5-tetrahydro-1,5-benzoxazepine (PubChem CID 82229965) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is 6,7,9-trimethyl-2,3,4,5-tetrahydro-1,5-benzoxazepine.
Analyze 6,7,9-trimethyl-2,3,4,5-tetrahydro-1,5-benzoxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7,9-trimethyl-2,3,4,5-tetrahydro-1,5-benzoxazepine?
The IUPAC name of 6,7,9-trimethyl-2,3,4,5-tetrahydro-1,5-benzoxazepine (CID 82229965) is 6,7,9-trimethyl-2,3,4,5-tetrahydro-1,5-benzoxazepine.
What is the SMILES notation for 6,7,9-trimethyl-2,3,4,5-tetrahydro-1,5-benzoxazepine?
The canonical SMILES for 6,7,9-trimethyl-2,3,4,5-tetrahydro-1,5-benzoxazepine is Cc1cc(C)c2c(c1C)NCCCO2.
What is the InChIKey of 6,7,9-trimethyl-2,3,4,5-tetrahydro-1,5-benzoxazepine?
The InChIKey is LHWLZGBRLRTINO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO/c1-8-7-9(2)12-11(10(8)3)13-5-4-6-14-12/h7,13H,4-6H2,1-3H3.
What are the key properties of 6,7,9-trimethyl-2,3,4,5-tetrahydro-1,5-benzoxazepine?
6,7,9-trimethyl-2,3,4,5-tetrahydro-1,5-benzoxazepine has a molecular weight of 191.27 g/mol, XLogP of 2.81, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7,9-trimethyl-2,3,4,5-tetrahydro-1,5-benzoxazepine is sourced from PubChem (CID 82229965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).