About 4,6-dichloro-2-methyl-1,3-benzoxazole
4,6-dichloro-2-methyl-1,3-benzoxazole (PubChem CID 82230193) has the molecular formula C8H5Cl2NO
and a molecular weight of 202.04 g/mol. Its IUPAC name is 4,6-dichloro-2-methyl-1,3-benzoxazole.
Molecular Properties
| Compound Name | 4,6-dichloro-2-methyl-1,3-benzoxazole |
| PubChem CID | 82230193 |
| Molecular Formula | C8H5Cl2NO |
| Molecular Weight | 202.04 g/mol |
| Exact Mass | 200.97 |
| IUPAC Name | 4,6-dichloro-2-methyl-1,3-benzoxazole |
| SMILES | Cc1nc2c(Cl)cc(Cl)cc2o1 |
| InChI | InChI=1S/C8H5Cl2NO/c1-4-11-8-6(10)2-5(9)3-7(8)12-4/h2-3H,1H3 |
| InChIKey | QFECLXAGNRZEAX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.04 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,6-dichloro-2-methyl-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dichloro-2-methyl-1,3-benzoxazole?
The IUPAC name of 4,6-dichloro-2-methyl-1,3-benzoxazole (CID 82230193) is 4,6-dichloro-2-methyl-1,3-benzoxazole.
What is the SMILES notation for 4,6-dichloro-2-methyl-1,3-benzoxazole?
The canonical SMILES for 4,6-dichloro-2-methyl-1,3-benzoxazole is Cc1nc2c(Cl)cc(Cl)cc2o1.
What is the InChIKey of 4,6-dichloro-2-methyl-1,3-benzoxazole?
The InChIKey is QFECLXAGNRZEAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5Cl2NO/c1-4-11-8-6(10)2-5(9)3-7(8)12-4/h2-3H,1H3.
What are the key properties of 4,6-dichloro-2-methyl-1,3-benzoxazole?
4,6-dichloro-2-methyl-1,3-benzoxazole has a molecular weight of 202.04 g/mol, XLogP of 3.44, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dichloro-2-methyl-1,3-benzoxazole is sourced from PubChem (CID 82230193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).