About 6,8-dichloro-4-methyl-2,3-dihydro-1,4-benzoxazine
6,8-dichloro-4-methyl-2,3-dihydro-1,4-benzoxazine (PubChem CID 82230773) has the molecular formula C9H9Cl2NO
and a molecular weight of 218.08 g/mol. Its IUPAC name is 6,8-dichloro-4-methyl-2,3-dihydro-1,4-benzoxazine.
Molecular Properties
| Compound Name | 6,8-dichloro-4-methyl-2,3-dihydro-1,4-benzoxazine |
| PubChem CID | 82230773 |
| Molecular Formula | C9H9Cl2NO |
| Molecular Weight | 218.08 g/mol |
| Exact Mass | 217.01 |
| IUPAC Name | 6,8-dichloro-4-methyl-2,3-dihydro-1,4-benzoxazine |
| SMILES | CN1CCOc2c(Cl)cc(Cl)cc21 |
| InChI | InChI=1S/C9H9Cl2NO/c1-12-2-3-13-9-7(11)4-6(10)5-8(9)12/h4-5H,2-3H2,1H3 |
| InChIKey | JEMKVQWRFHRKMO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.08 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,8-dichloro-4-methyl-2,3-dihydro-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dichloro-4-methyl-2,3-dihydro-1,4-benzoxazine?
The IUPAC name of 6,8-dichloro-4-methyl-2,3-dihydro-1,4-benzoxazine (CID 82230773) is 6,8-dichloro-4-methyl-2,3-dihydro-1,4-benzoxazine.
What is the SMILES notation for 6,8-dichloro-4-methyl-2,3-dihydro-1,4-benzoxazine?
The canonical SMILES for 6,8-dichloro-4-methyl-2,3-dihydro-1,4-benzoxazine is CN1CCOc2c(Cl)cc(Cl)cc21.
What is the InChIKey of 6,8-dichloro-4-methyl-2,3-dihydro-1,4-benzoxazine?
The InChIKey is JEMKVQWRFHRKMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9Cl2NO/c1-12-2-3-13-9-7(11)4-6(10)5-8(9)12/h4-5H,2-3H2,1H3.
What are the key properties of 6,8-dichloro-4-methyl-2,3-dihydro-1,4-benzoxazine?
6,8-dichloro-4-methyl-2,3-dihydro-1,4-benzoxazine has a molecular weight of 218.08 g/mol, XLogP of 2.82, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dichloro-4-methyl-2,3-dihydro-1,4-benzoxazine is sourced from PubChem (CID 82230773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).