About 2-cyclopentyl-1,3-benzothiazol-7-amine
2-cyclopentyl-1,3-benzothiazol-7-amine (PubChem CID 82230829) has the molecular formula C12H14N2S
and a molecular weight of 218.32 g/mol. Its IUPAC name is 2-cyclopentyl-1,3-benzothiazol-7-amine.
Molecular Properties
| Compound Name | 2-cyclopentyl-1,3-benzothiazol-7-amine |
| PubChem CID | 82230829 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 2-cyclopentyl-1,3-benzothiazol-7-amine |
| SMILES | Nc1cccc2nc(C3CCCC3)sc12 |
| InChI | InChI=1S/C12H14N2S/c13-9-6-3-7-10-11(9)15-12(14-10)8-4-1-2-5-8/h3,6-8H,1-2,4-5,13H2 |
| InChIKey | UCFKDGOWRJFDID-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopentyl-1,3-benzothiazol-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentyl-1,3-benzothiazol-7-amine?
The IUPAC name of 2-cyclopentyl-1,3-benzothiazol-7-amine (CID 82230829) is 2-cyclopentyl-1,3-benzothiazol-7-amine.
What is the SMILES notation for 2-cyclopentyl-1,3-benzothiazol-7-amine?
The canonical SMILES for 2-cyclopentyl-1,3-benzothiazol-7-amine is Nc1cccc2nc(C3CCCC3)sc12.
What is the InChIKey of 2-cyclopentyl-1,3-benzothiazol-7-amine?
The InChIKey is UCFKDGOWRJFDID-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2S/c13-9-6-3-7-10-11(9)15-12(14-10)8-4-1-2-5-8/h3,6-8H,1-2,4-5,13H2.
What are the key properties of 2-cyclopentyl-1,3-benzothiazol-7-amine?
2-cyclopentyl-1,3-benzothiazol-7-amine has a molecular weight of 218.32 g/mol, XLogP of 3.54, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentyl-1,3-benzothiazol-7-amine is sourced from PubChem (CID 82230829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).