C14H21NO — CID 82230918
8-tert-butyl-2,4-dimethyl-2,3-dihydro-1,4-benzoxazine (PubChem CID 82230918) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is 8-tert-butyl-2,4-dimethyl-2,3-dihydro-1,4-benzoxazine.
| Compound Name | 8-tert-butyl-2,4-dimethyl-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 82230918 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 8-tert-butyl-2,4-dimethyl-2,3-dihydro-1,4-benzoxazine |
| SMILES | CC1CN(C)c2cccc(C(C)(C)C)c2O1 |
| InChI | InChI=1S/C14H21NO/c1-10-9-15(5)12-8-6-7-11(13(12)16-10)14(2,3)4/h6-8,10H,9H2,1-5H3 |
| InChIKey | DXQBLCXNEYSKPZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |