About 6-tert-butyl-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-8-amine
6-tert-butyl-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-8-amine (PubChem CID 82231064) has the molecular formula C13H20N2O
and a molecular weight of 220.32 g/mol. Its IUPAC name is 6-tert-butyl-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-8-amine.
Molecular Properties
| Compound Name | 6-tert-butyl-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-8-amine |
| PubChem CID | 82231064 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 6-tert-butyl-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-8-amine |
| SMILES | CC1CNc2cc(C(C)(C)C)cc(N)c2O1 |
| InChI | InChI=1S/C13H20N2O/c1-8-7-15-11-6-9(13(2,3)4)5-10(14)12(11)16-8/h5-6,8,15H,7,14H2,1-4H3 |
| InChIKey | IUMANNZLXKZQGB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-tert-butyl-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-8-amine?
The IUPAC name of 6-tert-butyl-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-8-amine (CID 82231064) is 6-tert-butyl-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-8-amine.
What is the SMILES notation for 6-tert-butyl-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-8-amine?
The canonical SMILES for 6-tert-butyl-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-8-amine is CC1CNc2cc(C(C)(C)C)cc(N)c2O1.
What is the InChIKey of 6-tert-butyl-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-8-amine?
The InChIKey is IUMANNZLXKZQGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O/c1-8-7-15-11-6-9(13(2,3)4)5-10(14)12(11)16-8/h5-6,8,15H,7,14H2,1-4H3.
What are the key properties of 6-tert-butyl-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-8-amine?
6-tert-butyl-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-8-amine has a molecular weight of 220.32 g/mol, XLogP of 2.76, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-8-amine is sourced from PubChem (CID 82231064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).