About 4,6-dichloro-2-propan-2-yl-1,3-benzoxazole
4,6-dichloro-2-propan-2-yl-1,3-benzoxazole (PubChem CID 82231317) has the molecular formula C10H9Cl2NO
and a molecular weight of 230.09 g/mol. Its IUPAC name is 4,6-dichloro-2-propan-2-yl-1,3-benzoxazole.
Molecular Properties
| Compound Name | 4,6-dichloro-2-propan-2-yl-1,3-benzoxazole |
| PubChem CID | 82231317 |
| Molecular Formula | C10H9Cl2NO |
| Molecular Weight | 230.09 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | 4,6-dichloro-2-propan-2-yl-1,3-benzoxazole |
| SMILES | CC(C)c1nc2c(Cl)cc(Cl)cc2o1 |
| InChI | InChI=1S/C10H9Cl2NO/c1-5(2)10-13-9-7(12)3-6(11)4-8(9)14-10/h3-5H,1-2H3 |
| InChIKey | NMYPOCZPOZYRRX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.09 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,6-dichloro-2-propan-2-yl-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dichloro-2-propan-2-yl-1,3-benzoxazole?
The IUPAC name of 4,6-dichloro-2-propan-2-yl-1,3-benzoxazole (CID 82231317) is 4,6-dichloro-2-propan-2-yl-1,3-benzoxazole.
What is the SMILES notation for 4,6-dichloro-2-propan-2-yl-1,3-benzoxazole?
The canonical SMILES for 4,6-dichloro-2-propan-2-yl-1,3-benzoxazole is CC(C)c1nc2c(Cl)cc(Cl)cc2o1.
What is the InChIKey of 4,6-dichloro-2-propan-2-yl-1,3-benzoxazole?
The InChIKey is NMYPOCZPOZYRRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9Cl2NO/c1-5(2)10-13-9-7(12)3-6(11)4-8(9)14-10/h3-5H,1-2H3.
What are the key properties of 4,6-dichloro-2-propan-2-yl-1,3-benzoxazole?
4,6-dichloro-2-propan-2-yl-1,3-benzoxazole has a molecular weight of 230.09 g/mol, XLogP of 4.26, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dichloro-2-propan-2-yl-1,3-benzoxazole is sourced from PubChem (CID 82231317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).