About 7-amino-4,6-dichloro-3-methyl-1,3-benzoxazol-2-one
7-amino-4,6-dichloro-3-methyl-1,3-benzoxazol-2-one (PubChem CID 82231480) has the molecular formula C8H6Cl2N2O2
and a molecular weight of 233.05 g/mol. Its IUPAC name is 7-amino-4,6-dichloro-3-methyl-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | 7-amino-4,6-dichloro-3-methyl-1,3-benzoxazol-2-one |
| PubChem CID | 82231480 |
| Molecular Formula | C8H6Cl2N2O2 |
| Molecular Weight | 233.05 g/mol |
| Exact Mass | 231.98 |
| IUPAC Name | 7-amino-4,6-dichloro-3-methyl-1,3-benzoxazol-2-one |
| SMILES | Cn1c(=O)oc2c(N)c(Cl)cc(Cl)c21 |
| InChI | InChI=1S/C8H6Cl2N2O2/c1-12-6-4(10)2-3(9)5(11)7(6)14-8(12)13/h2H,11H2,1H3 |
| InChIKey | YNDBXCVYJDFILI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 61.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.05 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 7-amino-4,6-dichloro-3-methyl-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-4,6-dichloro-3-methyl-1,3-benzoxazol-2-one?
The IUPAC name of 7-amino-4,6-dichloro-3-methyl-1,3-benzoxazol-2-one (CID 82231480) is 7-amino-4,6-dichloro-3-methyl-1,3-benzoxazol-2-one.
What is the SMILES notation for 7-amino-4,6-dichloro-3-methyl-1,3-benzoxazol-2-one?
The canonical SMILES for 7-amino-4,6-dichloro-3-methyl-1,3-benzoxazol-2-one is Cn1c(=O)oc2c(N)c(Cl)cc(Cl)c21.
What is the InChIKey of 7-amino-4,6-dichloro-3-methyl-1,3-benzoxazol-2-one?
The InChIKey is YNDBXCVYJDFILI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Cl2N2O2/c1-12-6-4(10)2-3(9)5(11)7(6)14-8(12)13/h2H,11H2,1H3.
What are the key properties of 7-amino-4,6-dichloro-3-methyl-1,3-benzoxazol-2-one?
7-amino-4,6-dichloro-3-methyl-1,3-benzoxazol-2-one has a molecular weight of 233.05 g/mol, XLogP of 2.02, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-4,6-dichloro-3-methyl-1,3-benzoxazol-2-one is sourced from PubChem (CID 82231480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).