C11H11F2N3O — CID 82231812
5,7-difluoro-2-piperazin-1-yl-1,3-benzoxazole (PubChem CID 82231812) has the molecular formula C11H11F2N3O and a molecular weight of 239.22 g/mol. Its IUPAC name is 5,7-difluoro-2-piperazin-1-yl-1,3-benzoxazole.
| Compound Name | 5,7-difluoro-2-piperazin-1-yl-1,3-benzoxazole |
|---|---|
| PubChem CID | 82231812 |
| Molecular Formula | C11H11F2N3O |
| Molecular Weight | 239.22 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 5,7-difluoro-2-piperazin-1-yl-1,3-benzoxazole |
| SMILES | Fc1cc(F)c2oc(N3CCNCC3)nc2c1 |
| InChI | InChI=1S/C11H11F2N3O/c12-7-5-8(13)10-9(6-7)15-11(17-10)16-3-1-14-2-4-16/h5-6,14H,1-4H2 |
| InChIKey | ZDHMPLXSVNMTDF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.22 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |