About 5,7-difluoro-2-piperazin-1-yl-1,3-benzoxazole
5,7-difluoro-2-piperazin-1-yl-1,3-benzoxazole (PubChem CID 82231812) has the molecular formula C11H11F2N3O
and a molecular weight of 239.22 g/mol. Its IUPAC name is 5,7-difluoro-2-piperazin-1-yl-1,3-benzoxazole.
Molecular Properties
| Compound Name | 5,7-difluoro-2-piperazin-1-yl-1,3-benzoxazole |
| PubChem CID | 82231812 |
| Molecular Formula | C11H11F2N3O |
| Molecular Weight | 239.22 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 5,7-difluoro-2-piperazin-1-yl-1,3-benzoxazole |
| SMILES | Fc1cc(F)c2oc(N3CCNCC3)nc2c1 |
| InChI | InChI=1S/C11H11F2N3O/c12-7-5-8(13)10-9(6-7)15-11(17-10)16-3-1-14-2-4-16/h5-6,14H,1-4H2 |
| InChIKey | ZDHMPLXSVNMTDF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.22 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,7-difluoro-2-piperazin-1-yl-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-difluoro-2-piperazin-1-yl-1,3-benzoxazole?
The IUPAC name of 5,7-difluoro-2-piperazin-1-yl-1,3-benzoxazole (CID 82231812) is 5,7-difluoro-2-piperazin-1-yl-1,3-benzoxazole.
What is the SMILES notation for 5,7-difluoro-2-piperazin-1-yl-1,3-benzoxazole?
The canonical SMILES for 5,7-difluoro-2-piperazin-1-yl-1,3-benzoxazole is Fc1cc(F)c2oc(N3CCNCC3)nc2c1.
What is the InChIKey of 5,7-difluoro-2-piperazin-1-yl-1,3-benzoxazole?
The InChIKey is ZDHMPLXSVNMTDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F2N3O/c12-7-5-8(13)10-9(6-7)15-11(17-10)16-3-1-14-2-4-16/h5-6,14H,1-4H2.
What are the key properties of 5,7-difluoro-2-piperazin-1-yl-1,3-benzoxazole?
5,7-difluoro-2-piperazin-1-yl-1,3-benzoxazole has a molecular weight of 239.22 g/mol, XLogP of 1.52, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-difluoro-2-piperazin-1-yl-1,3-benzoxazole is sourced from PubChem (CID 82231812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).