C11H13ClN2O2 — CID 82231876
9-amino-7-chloro-6,8-dimethyl-3,5-dihydro-2H-1,5-benzoxazepin-4-one (PubChem CID 82231876) has the molecular formula C11H13ClN2O2 and a molecular weight of 240.69 g/mol. Its IUPAC name is 9-amino-7-chloro-6,8-dimethyl-3,5-dihydro-2H-1,5-benzoxazepin-4-one.
| Compound Name | 9-amino-7-chloro-6,8-dimethyl-3,5-dihydro-2H-1,5-benzoxazepin-4-one |
|---|---|
| PubChem CID | 82231876 |
| Molecular Formula | C11H13ClN2O2 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 9-amino-7-chloro-6,8-dimethyl-3,5-dihydro-2H-1,5-benzoxazepin-4-one |
| SMILES | Cc1c(N)c2c(c(C)c1Cl)NC(=O)CCO2 |
| InChI | InChI=1S/C11H13ClN2O2/c1-5-8(12)6(2)10-11(9(5)13)16-4-3-7(15)14-10/h3-4,13H2,1-2H3,(H,14,15) |
| InChIKey | LULPKOURVCBKEA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|