C13H15NO4 — CID 82232420
7,10-dimethyl-2,3,7,8-tetrahydro-[1,4]dioxino[2,3-h][1,5]benzoxazepin-9-one (PubChem CID 82232420) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is 7,10-dimethyl-2,3,7,8-tetrahydro-[1,4]dioxino[2,3-h][1,5]benzoxazepin-9-one.
| Compound Name | 7,10-dimethyl-2,3,7,8-tetrahydro-[1,4]dioxino[2,3-h][1,5]benzoxazepin-9-one |
|---|---|
| PubChem CID | 82232420 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 7,10-dimethyl-2,3,7,8-tetrahydro-[1,4]dioxino[2,3-h][1,5]benzoxazepin-9-one |
| SMILES | CC1CC(=O)N(C)c2cc3c(cc2O1)OCCO3 |
| InChI | InChI=1S/C13H15NO4/c1-8-5-13(15)14(2)9-6-11-12(7-10(9)18-8)17-4-3-16-11/h6-8H,3-5H2,1-2H3 |
| InChIKey | VXUOPBZFZJFBPS-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |