C10H10Cl2N2O2 — CID 82232993
9-amino-6,8-dichloro-3-methyl-3,5-dihydro-2H-1,5-benzoxazepin-4-one (PubChem CID 82232993) has the molecular formula C10H10Cl2N2O2 and a molecular weight of 261.11 g/mol. Its IUPAC name is 9-amino-6,8-dichloro-3-methyl-3,5-dihydro-2H-1,5-benzoxazepin-4-one.
| Compound Name | 9-amino-6,8-dichloro-3-methyl-3,5-dihydro-2H-1,5-benzoxazepin-4-one |
|---|---|
| PubChem CID | 82232993 |
| Molecular Formula | C10H10Cl2N2O2 |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | 9-amino-6,8-dichloro-3-methyl-3,5-dihydro-2H-1,5-benzoxazepin-4-one |
| SMILES | CC1COc2c(N)c(Cl)cc(Cl)c2NC1=O |
| InChI | InChI=1S/C10H10Cl2N2O2/c1-4-3-16-9-7(13)5(11)2-6(12)8(9)14-10(4)15/h2,4H,3,13H2,1H3,(H,14,15) |
| InChIKey | VBPPIDDRYMPWHH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|