C10H10Cl2N2O2 — CID 82233013
2-(aminomethyl)-5,8-dichloro-4-methyl-1,4-benzoxazin-3-one (PubChem CID 82233013) has the molecular formula C10H10Cl2N2O2 and a molecular weight of 261.11 g/mol. Its IUPAC name is 2-(aminomethyl)-5,8-dichloro-4-methyl-1,4-benzoxazin-3-one.
| Compound Name | 2-(aminomethyl)-5,8-dichloro-4-methyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82233013 |
| Molecular Formula | C10H10Cl2N2O2 |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | 2-(aminomethyl)-5,8-dichloro-4-methyl-1,4-benzoxazin-3-one |
| SMILES | CN1C(=O)C(CN)Oc2c(Cl)ccc(Cl)c21 |
| InChI | InChI=1S/C10H10Cl2N2O2/c1-14-8-5(11)2-3-6(12)9(8)16-7(4-13)10(14)15/h2-3,7H,4,13H2,1H3 |
| InChIKey | CEGWXERFKLLPGL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |