C14H19N3O2 — CID 82233075
2-(2-methoxyethyl)-7-piperazin-1-yl-1,3-benzoxazole (PubChem CID 82233075) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 2-(2-methoxyethyl)-7-piperazin-1-yl-1,3-benzoxazole.
| Compound Name | 2-(2-methoxyethyl)-7-piperazin-1-yl-1,3-benzoxazole |
|---|---|
| PubChem CID | 82233075 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 2-(2-methoxyethyl)-7-piperazin-1-yl-1,3-benzoxazole |
| SMILES | COCCc1nc2cccc(N3CCNCC3)c2o1 |
| InChI | InChI=1S/C14H19N3O2/c1-18-10-5-13-16-11-3-2-4-12(14(11)19-13)17-8-6-15-7-9-17/h2-4,15H,5-10H2,1H3 |
| InChIKey | HNSWEZPQNZNCBM-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 50.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |