C15H23N3O — CID 82233102
2,5-dimethyl-8-piperazin-1-yl-3,4-dihydro-2H-1,5-benzoxazepine (PubChem CID 82233102) has the molecular formula C15H23N3O and a molecular weight of 261.37 g/mol. Its IUPAC name is 2,5-dimethyl-8-piperazin-1-yl-3,4-dihydro-2H-1,5-benzoxazepine.
| Compound Name | 2,5-dimethyl-8-piperazin-1-yl-3,4-dihydro-2H-1,5-benzoxazepine |
|---|---|
| PubChem CID | 82233102 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | 2,5-dimethyl-8-piperazin-1-yl-3,4-dihydro-2H-1,5-benzoxazepine |
| SMILES | CC1CCN(C)c2ccc(N3CCNCC3)cc2O1 |
| InChI | InChI=1S/C15H23N3O/c1-12-5-8-17(2)14-4-3-13(11-15(14)19-12)18-9-6-16-7-10-18/h3-4,11-12,16H,5-10H2,1-2H3 |
| InChIKey | TWIXROGTVUUFHD-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|