About 9-bromo-5,7-dimethyl-2,3-dihydro-1,5-benzoxazepin-4-one
9-bromo-5,7-dimethyl-2,3-dihydro-1,5-benzoxazepin-4-one (PubChem CID 82233529) has the molecular formula C11H12BrNO2
and a molecular weight of 270.13 g/mol. Its IUPAC name is 9-bromo-5,7-dimethyl-2,3-dihydro-1,5-benzoxazepin-4-one.
Molecular Properties
| Compound Name | 9-bromo-5,7-dimethyl-2,3-dihydro-1,5-benzoxazepin-4-one |
| PubChem CID | 82233529 |
| Molecular Formula | C11H12BrNO2 |
| Molecular Weight | 270.13 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | 9-bromo-5,7-dimethyl-2,3-dihydro-1,5-benzoxazepin-4-one |
| SMILES | Cc1cc(Br)c2c(c1)N(C)C(=O)CCO2 |
| InChI | InChI=1S/C11H12BrNO2/c1-7-5-8(12)11-9(6-7)13(2)10(14)3-4-15-11/h5-6H,3-4H2,1-2H3 |
| InChIKey | ZZGYTEWHNRDWKN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.13 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-bromo-5,7-dimethyl-2,3-dihydro-1,5-benzoxazepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-bromo-5,7-dimethyl-2,3-dihydro-1,5-benzoxazepin-4-one?
The IUPAC name of 9-bromo-5,7-dimethyl-2,3-dihydro-1,5-benzoxazepin-4-one (CID 82233529) is 9-bromo-5,7-dimethyl-2,3-dihydro-1,5-benzoxazepin-4-one.
What is the SMILES notation for 9-bromo-5,7-dimethyl-2,3-dihydro-1,5-benzoxazepin-4-one?
The canonical SMILES for 9-bromo-5,7-dimethyl-2,3-dihydro-1,5-benzoxazepin-4-one is Cc1cc(Br)c2c(c1)N(C)C(=O)CCO2.
What is the InChIKey of 9-bromo-5,7-dimethyl-2,3-dihydro-1,5-benzoxazepin-4-one?
The InChIKey is ZZGYTEWHNRDWKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12BrNO2/c1-7-5-8(12)11-9(6-7)13(2)10(14)3-4-15-11/h5-6H,3-4H2,1-2H3.
What are the key properties of 9-bromo-5,7-dimethyl-2,3-dihydro-1,5-benzoxazepin-4-one?
9-bromo-5,7-dimethyl-2,3-dihydro-1,5-benzoxazepin-4-one has a molecular weight of 270.13 g/mol, XLogP of 2.50, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-bromo-5,7-dimethyl-2,3-dihydro-1,5-benzoxazepin-4-one is sourced from PubChem (CID 82233529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).