C11H13BrN2O2 — CID 82233839
2-(2-aminoethyl)-6-bromo-4-methyl-1,4-benzoxazin-3-one (PubChem CID 82233839) has the molecular formula C11H13BrN2O2 and a molecular weight of 285.14 g/mol. Its IUPAC name is 2-(2-aminoethyl)-6-bromo-4-methyl-1,4-benzoxazin-3-one.
| Compound Name | 2-(2-aminoethyl)-6-bromo-4-methyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82233839 |
| Molecular Formula | C11H13BrN2O2 |
| Molecular Weight | 285.14 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 2-(2-aminoethyl)-6-bromo-4-methyl-1,4-benzoxazin-3-one |
| SMILES | CN1C(=O)C(CCN)Oc2ccc(Br)cc21 |
| InChI | InChI=1S/C11H13BrN2O2/c1-14-8-6-7(12)2-3-9(8)16-10(4-5-13)11(14)15/h2-3,6,10H,4-5,13H2,1H3 |
| InChIKey | BKXHJORQGGGVAQ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.14 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |