C12H14BrN3O2 — CID 82234347
8-bromo-6-piperazin-1-yl-4H-1,4-benzoxazin-3-one (PubChem CID 82234347) has the molecular formula C12H14BrN3O2 and a molecular weight of 312.17 g/mol. Its IUPAC name is 8-bromo-6-piperazin-1-yl-4H-1,4-benzoxazin-3-one.
| Compound Name | 8-bromo-6-piperazin-1-yl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82234347 |
| Molecular Formula | C12H14BrN3O2 |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 8-bromo-6-piperazin-1-yl-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2c(Br)cc(N3CCNCC3)cc2N1 |
| InChI | InChI=1S/C12H14BrN3O2/c13-9-5-8(16-3-1-14-2-4-16)6-10-12(9)18-7-11(17)15-10/h5-6,14H,1-4,7H2,(H,15,17) |
| InChIKey | BGVXDBFMNHANRC-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|