C4H3N5O2 — CID 82234748
4-(1,2,4-oxadiazol-5-yl)-1,2,5-oxadiazol-3-amine (PubChem CID 82234748) has the molecular formula C4H3N5O2 and a molecular weight of 153.10 g/mol. Its IUPAC name is 4-(1,2,4-oxadiazol-5-yl)-1,2,5-oxadiazol-3-amine.
| Compound Name | 4-(1,2,4-oxadiazol-5-yl)-1,2,5-oxadiazol-3-amine |
|---|---|
| PubChem CID | 82234748 |
| Molecular Formula | C4H3N5O2 |
| Molecular Weight | 153.10 g/mol |
| Exact Mass | 153.03 |
| IUPAC Name | 4-(1,2,4-oxadiazol-5-yl)-1,2,5-oxadiazol-3-amine |
| SMILES | Nc1nonc1-c1ncno1 |
| InChI | InChI=1S/C4H3N5O2/c5-3-2(8-11-9-3)4-6-1-7-10-4/h1H,(H2,5,9) |
| InChIKey | VIWRJVWFCYILRU-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.10 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |