About 4-methyl-5-(1,2,4-oxadiazol-5-yl)-1,3-thiazol-2-amine
4-methyl-5-(1,2,4-oxadiazol-5-yl)-1,3-thiazol-2-amine (PubChem CID 82234750) has the molecular formula C6H6N4OS
and a molecular weight of 182.21 g/mol. Its IUPAC name is 4-methyl-5-(1,2,4-oxadiazol-5-yl)-1,3-thiazol-2-amine.
Analyze 4-methyl-5-(1,2,4-oxadiazol-5-yl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-5-(1,2,4-oxadiazol-5-yl)-1,3-thiazol-2-amine?
The IUPAC name of 4-methyl-5-(1,2,4-oxadiazol-5-yl)-1,3-thiazol-2-amine (CID 82234750) is 4-methyl-5-(1,2,4-oxadiazol-5-yl)-1,3-thiazol-2-amine.
What is the SMILES notation for 4-methyl-5-(1,2,4-oxadiazol-5-yl)-1,3-thiazol-2-amine?
The canonical SMILES for 4-methyl-5-(1,2,4-oxadiazol-5-yl)-1,3-thiazol-2-amine is Cc1nc(N)sc1-c1ncno1.
What is the InChIKey of 4-methyl-5-(1,2,4-oxadiazol-5-yl)-1,3-thiazol-2-amine?
The InChIKey is GFWUFMYYJMBEHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4OS/c1-3-4(12-6(7)10-3)5-8-2-9-11-5/h2H,1H3,(H2,7,10).
What are the key properties of 4-methyl-5-(1,2,4-oxadiazol-5-yl)-1,3-thiazol-2-amine?
4-methyl-5-(1,2,4-oxadiazol-5-yl)-1,3-thiazol-2-amine has a molecular weight of 182.21 g/mol, XLogP of 1.08, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-5-(1,2,4-oxadiazol-5-yl)-1,3-thiazol-2-amine is sourced from PubChem (CID 82234750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).