C16H12O4S2 — CID 822348
9lambda6,18lambda6-dithiapentacyclo[9.7.0.02,10.03,8.012,17]octadeca-3,5,7,12,14,16-hexaene 9,9,18,18-tetraoxide (PubChem CID 822348) has the molecular formula C16H12O4S2 and a molecular weight of 332.40 g/mol. Its IUPAC name is 9lambda6,18lambda6-dithiapentacyclo[9.7.0.02,10.03,8.012,17]octadeca-3,5,7,12,14,16-hexaene 9,9,18,18-tetraoxide.
| Compound Name | 9lambda6,18lambda6-dithiapentacyclo[9.7.0.02,10.03,8.012,17]octadeca-3,5,7,12,14,16-hexaene 9,9,18,18-tetraoxide |
|---|---|
| PubChem CID | 822348 |
| Molecular Formula | C16H12O4S2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 9lambda6,18lambda6-dithiapentacyclo[9.7.0.02,10.03,8.012,17]octadeca-3,5,7,12,14,16-hexaene 9,9,18,18-tetraoxide |
| SMILES | O=S1(=O)c2ccccc2C2C1C1c3ccccc3S(=O)(=O)C21 |
| InChI | InChI=1S/C16H12O4S2/c17-21(18)11-7-3-1-5-9(11)13-15(21)14-10-6-2-4-8-12(10)22(19,20)16(13)14/h1-8,13-16H |
| InChIKey | IQZFZXBGCBIKBO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |