2-(2,5-dimethylmorpholin-4-yl)-2-methylpropanoic acid

C10H19NO3 — CID 82235052

IUPAC2-(2,5-dimethylmorpholin-4-yl)-2-methylpropanoic acid
SMILESCC1CN(C(C)(C)C(=O)O)C(C)CO1
InChIInChI=1S/C10H19NO3/c1-7-6-14-8(2)5-11(7)10(3,4)9(12)13/h7-8H,5-6H2,1-4H3,(H,12,13)
InChIKeyYXKAKMLLSFGRQT-UHFFFAOYSA-N
MW201.27 g/mol
LogP0.96
Rot. Bonds2

About 2-(2,5-dimethylmorpholin-4-yl)-2-methylpropanoic acid

2-(2,5-dimethylmorpholin-4-yl)-2-methylpropanoic acid (PubChem CID 82235052) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-(2,5-dimethylmorpholin-4-yl)-2-methylpropanoic acid.

Molecular Properties

Compound Name2-(2,5-dimethylmorpholin-4-yl)-2-methylpropanoic acid
PubChem CID82235052
Molecular FormulaC10H19NO3
Molecular Weight201.27 g/mol
Exact Mass201.14
IUPAC Name2-(2,5-dimethylmorpholin-4-yl)-2-methylpropanoic acid
SMILESCC1CN(C(C)(C)C(=O)O)C(C)CO1
InChIInChI=1S/C10H19NO3/c1-7-6-14-8(2)5-11(7)10(3,4)9(12)13/h7-8H,5-6H2,1-4H3,(H,12,13)
InChIKeyYXKAKMLLSFGRQT-UHFFFAOYSA-N
XLogP0.96
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500201.27
LogP ≤ 50.96
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(2,5-dimethylmorpholin-4-yl)-2-methylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,5-dimethylmorpholin-4-yl)-2-methylpropanoic acid?
The IUPAC name of 2-(2,5-dimethylmorpholin-4-yl)-2-methylpropanoic acid (CID 82235052) is 2-(2,5-dimethylmorpholin-4-yl)-2-methylpropanoic acid.
What is the SMILES notation for 2-(2,5-dimethylmorpholin-4-yl)-2-methylpropanoic acid?
The canonical SMILES for 2-(2,5-dimethylmorpholin-4-yl)-2-methylpropanoic acid is CC1CN(C(C)(C)C(=O)O)C(C)CO1.
What is the InChIKey of 2-(2,5-dimethylmorpholin-4-yl)-2-methylpropanoic acid?
The InChIKey is YXKAKMLLSFGRQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO3/c1-7-6-14-8(2)5-11(7)10(3,4)9(12)13/h7-8H,5-6H2,1-4H3,(H,12,13).
What are the key properties of 2-(2,5-dimethylmorpholin-4-yl)-2-methylpropanoic acid?
2-(2,5-dimethylmorpholin-4-yl)-2-methylpropanoic acid has a molecular weight of 201.27 g/mol, XLogP of 0.96, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethylmorpholin-4-yl)-2-methylpropanoic acid is sourced from PubChem (CID 82235052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).