About 4-N,4-N-diethyl-1H-pyrazole-4,5-diamine
4-N,4-N-diethyl-1H-pyrazole-4,5-diamine (PubChem CID 82236212) has the molecular formula C7H14N4
and a molecular weight of 154.22 g/mol. Its IUPAC name is 4-N,4-N-diethyl-1H-pyrazole-4,5-diamine.
Molecular Properties
| Compound Name | 4-N,4-N-diethyl-1H-pyrazole-4,5-diamine |
| PubChem CID | 82236212 |
| Molecular Formula | C7H14N4 |
| Molecular Weight | 154.22 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | 4-N,4-N-diethyl-1H-pyrazole-4,5-diamine |
| SMILES | CCN(CC)c1cn[nH]c1N |
| InChI | InChI=1S/C7H14N4/c1-3-11(4-2)6-5-9-10-7(6)8/h5H,3-4H2,1-2H3,(H3,8,9,10) |
| InChIKey | IADQXNPWKZITPB-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.22 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-N,4-N-diethyl-1H-pyrazole-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N,4-N-diethyl-1H-pyrazole-4,5-diamine?
The IUPAC name of 4-N,4-N-diethyl-1H-pyrazole-4,5-diamine (CID 82236212) is 4-N,4-N-diethyl-1H-pyrazole-4,5-diamine.
What is the SMILES notation for 4-N,4-N-diethyl-1H-pyrazole-4,5-diamine?
The canonical SMILES for 4-N,4-N-diethyl-1H-pyrazole-4,5-diamine is CCN(CC)c1cn[nH]c1N.
What is the InChIKey of 4-N,4-N-diethyl-1H-pyrazole-4,5-diamine?
The InChIKey is IADQXNPWKZITPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4/c1-3-11(4-2)6-5-9-10-7(6)8/h5H,3-4H2,1-2H3,(H3,8,9,10).
What are the key properties of 4-N,4-N-diethyl-1H-pyrazole-4,5-diamine?
4-N,4-N-diethyl-1H-pyrazole-4,5-diamine has a molecular weight of 154.22 g/mol, XLogP of 0.84, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N,4-N-diethyl-1H-pyrazole-4,5-diamine is sourced from PubChem (CID 82236212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).