About 1-(3-nitro-1,2,4-triazol-1-yl)cyclopentane-1-carboxylic acid
1-(3-nitro-1,2,4-triazol-1-yl)cyclopentane-1-carboxylic acid (PubChem CID 82236516) has the molecular formula C8H10N4O4
and a molecular weight of 226.19 g/mol. Its IUPAC name is 1-(3-nitro-1,2,4-triazol-1-yl)cyclopentane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-(3-nitro-1,2,4-triazol-1-yl)cyclopentane-1-carboxylic acid |
| PubChem CID | 82236516 |
| Molecular Formula | C8H10N4O4 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 1-(3-nitro-1,2,4-triazol-1-yl)cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1(n2cnc([N+](=O)[O-])n2)CCCC1 |
| InChI | InChI=1S/C8H10N4O4/c13-6(14)8(3-1-2-4-8)11-5-9-7(10-11)12(15)16/h5H,1-4H2,(H,13,14) |
| InChIKey | QQARMBLKBZIGCP-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-nitro-1,2,4-triazol-1-yl)cyclopentane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-nitro-1,2,4-triazol-1-yl)cyclopentane-1-carboxylic acid?
The IUPAC name of 1-(3-nitro-1,2,4-triazol-1-yl)cyclopentane-1-carboxylic acid (CID 82236516) is 1-(3-nitro-1,2,4-triazol-1-yl)cyclopentane-1-carboxylic acid.
What is the SMILES notation for 1-(3-nitro-1,2,4-triazol-1-yl)cyclopentane-1-carboxylic acid?
The canonical SMILES for 1-(3-nitro-1,2,4-triazol-1-yl)cyclopentane-1-carboxylic acid is O=C(O)C1(n2cnc([N+](=O)[O-])n2)CCCC1.
What is the InChIKey of 1-(3-nitro-1,2,4-triazol-1-yl)cyclopentane-1-carboxylic acid?
The InChIKey is QQARMBLKBZIGCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O4/c13-6(14)8(3-1-2-4-8)11-5-9-7(10-11)12(15)16/h5H,1-4H2,(H,13,14).
What are the key properties of 1-(3-nitro-1,2,4-triazol-1-yl)cyclopentane-1-carboxylic acid?
1-(3-nitro-1,2,4-triazol-1-yl)cyclopentane-1-carboxylic acid has a molecular weight of 226.19 g/mol, XLogP of 0.54, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-nitro-1,2,4-triazol-1-yl)cyclopentane-1-carboxylic acid is sourced from PubChem (CID 82236516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).