C11H14N4O — CID 82237771
4-N-(4-methoxy-2-methylphenyl)-1H-pyrazole-4,5-diamine (PubChem CID 82237771) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 4-N-(4-methoxy-2-methylphenyl)-1H-pyrazole-4,5-diamine.
| Compound Name | 4-N-(4-methoxy-2-methylphenyl)-1H-pyrazole-4,5-diamine |
|---|---|
| PubChem CID | 82237771 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 4-N-(4-methoxy-2-methylphenyl)-1H-pyrazole-4,5-diamine |
| SMILES | COc1ccc(Nc2cn[nH]c2N)c(C)c1 |
| InChI | InChI=1S/C11H14N4O/c1-7-5-8(16-2)3-4-9(7)14-10-6-13-15-11(10)12/h3-6,14H,1-2H3,(H3,12,13,15) |
| InChIKey | WLBNRSFSSGHOHF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |