About N-[2-(4,5-dimethyl-1H-imidazol-2-yl)ethyl]propan-2-amine
N-[2-(4,5-dimethyl-1H-imidazol-2-yl)ethyl]propan-2-amine (PubChem CID 82238183) has the molecular formula C10H19N3
and a molecular weight of 181.28 g/mol. Its IUPAC name is N-[2-(4,5-dimethyl-1H-imidazol-2-yl)ethyl]propan-2-amine.
Molecular Properties
| Compound Name | N-[2-(4,5-dimethyl-1H-imidazol-2-yl)ethyl]propan-2-amine |
| PubChem CID | 82238183 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | N-[2-(4,5-dimethyl-1H-imidazol-2-yl)ethyl]propan-2-amine |
| SMILES | Cc1nc(CCNC(C)C)[nH]c1C |
| InChI | InChI=1S/C10H19N3/c1-7(2)11-6-5-10-12-8(3)9(4)13-10/h7,11H,5-6H2,1-4H3,(H,12,13) |
| InChIKey | GDDYTVVZUWZWNZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[2-(4,5-dimethyl-1H-imidazol-2-yl)ethyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4,5-dimethyl-1H-imidazol-2-yl)ethyl]propan-2-amine?
The IUPAC name of N-[2-(4,5-dimethyl-1H-imidazol-2-yl)ethyl]propan-2-amine (CID 82238183) is N-[2-(4,5-dimethyl-1H-imidazol-2-yl)ethyl]propan-2-amine.
What is the SMILES notation for N-[2-(4,5-dimethyl-1H-imidazol-2-yl)ethyl]propan-2-amine?
The canonical SMILES for N-[2-(4,5-dimethyl-1H-imidazol-2-yl)ethyl]propan-2-amine is Cc1nc(CCNC(C)C)[nH]c1C.
What is the InChIKey of N-[2-(4,5-dimethyl-1H-imidazol-2-yl)ethyl]propan-2-amine?
The InChIKey is GDDYTVVZUWZWNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3/c1-7(2)11-6-5-10-12-8(3)9(4)13-10/h7,11H,5-6H2,1-4H3,(H,12,13).
What are the key properties of N-[2-(4,5-dimethyl-1H-imidazol-2-yl)ethyl]propan-2-amine?
N-[2-(4,5-dimethyl-1H-imidazol-2-yl)ethyl]propan-2-amine has a molecular weight of 181.28 g/mol, XLogP of 1.57, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4,5-dimethyl-1H-imidazol-2-yl)ethyl]propan-2-amine is sourced from PubChem (CID 82238183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).