C17H16N4O3 — CID 82240227
3-nitro-N-[4-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]benzamide (PubChem CID 82240227) has the molecular formula C17H16N4O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is 3-nitro-N-[4-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]benzamide.
| Compound Name | 3-nitro-N-[4-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 82240227 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 3-nitro-N-[4-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(C2=NCCCN2)cc1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H16N4O3/c22-17(13-3-1-4-15(11-13)21(23)24)20-14-7-5-12(6-8-14)16-18-9-2-10-19-16/h1,3-8,11H,2,9-10H2,(H,18,19)(H,20,22) |
| InChIKey | ATVOJDRRWAOEMS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 96.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|