C18H21NO5 — CID 82240388
3-[6-(carboxymethyl)-2-methyl-4-oxo-1-propan-2-ylquinolin-3-yl]propanoic acid (PubChem CID 82240388) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is 3-[6-(carboxymethyl)-2-methyl-4-oxo-1-propan-2-ylquinolin-3-yl]propanoic acid.
| Compound Name | 3-[6-(carboxymethyl)-2-methyl-4-oxo-1-propan-2-ylquinolin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 82240388 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 3-[6-(carboxymethyl)-2-methyl-4-oxo-1-propan-2-ylquinolin-3-yl]propanoic acid |
| SMILES | Cc1c(CCC(=O)O)c(=O)c2cc(CC(=O)O)ccc2n1C(C)C |
| InChI | InChI=1S/C18H21NO5/c1-10(2)19-11(3)13(5-7-16(20)21)18(24)14-8-12(9-17(22)23)4-6-15(14)19/h4,6,8,10H,5,7,9H2,1-3H3,(H,20,21)(H,22,23) |
| InChIKey | SLTSIRBISNGEEU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 96.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |