About 9-butan-2-yl-3,9-diazabicyclo[4.2.1]nonane
9-butan-2-yl-3,9-diazabicyclo[4.2.1]nonane (PubChem CID 82240951) has the molecular formula C11H22N2
and a molecular weight of 182.31 g/mol. Its IUPAC name is 9-butan-2-yl-3,9-diazabicyclo[4.2.1]nonane.
Molecular Properties
| Compound Name | 9-butan-2-yl-3,9-diazabicyclo[4.2.1]nonane |
| PubChem CID | 82240951 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 9-butan-2-yl-3,9-diazabicyclo[4.2.1]nonane |
| SMILES | CCC(C)N1C2CCNCC1CC2 |
| InChI | InChI=1S/C11H22N2/c1-3-9(2)13-10-4-5-11(13)8-12-7-6-10/h9-12H,3-8H2,1-2H3 |
| InChIKey | VILMFZPFRRJEPF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-butan-2-yl-3,9-diazabicyclo[4.2.1]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-butan-2-yl-3,9-diazabicyclo[4.2.1]nonane?
The IUPAC name of 9-butan-2-yl-3,9-diazabicyclo[4.2.1]nonane (CID 82240951) is 9-butan-2-yl-3,9-diazabicyclo[4.2.1]nonane.
What is the SMILES notation for 9-butan-2-yl-3,9-diazabicyclo[4.2.1]nonane?
The canonical SMILES for 9-butan-2-yl-3,9-diazabicyclo[4.2.1]nonane is CCC(C)N1C2CCNCC1CC2.
What is the InChIKey of 9-butan-2-yl-3,9-diazabicyclo[4.2.1]nonane?
The InChIKey is VILMFZPFRRJEPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2/c1-3-9(2)13-10-4-5-11(13)8-12-7-6-10/h9-12H,3-8H2,1-2H3.
What are the key properties of 9-butan-2-yl-3,9-diazabicyclo[4.2.1]nonane?
9-butan-2-yl-3,9-diazabicyclo[4.2.1]nonane has a molecular weight of 182.31 g/mol, XLogP of 1.61, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-butan-2-yl-3,9-diazabicyclo[4.2.1]nonane is sourced from PubChem (CID 82240951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).