About (1-butan-2-yl-1,4-diazepan-2-yl)methanol
(1-butan-2-yl-1,4-diazepan-2-yl)methanol (PubChem CID 82241022) has the molecular formula C10H22N2O
and a molecular weight of 186.30 g/mol. Its IUPAC name is (1-butan-2-yl-1,4-diazepan-2-yl)methanol.
Molecular Properties
| Compound Name | (1-butan-2-yl-1,4-diazepan-2-yl)methanol |
| PubChem CID | 82241022 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | (1-butan-2-yl-1,4-diazepan-2-yl)methanol |
| SMILES | CCC(C)N1CCCNCC1CO |
| InChI | InChI=1S/C10H22N2O/c1-3-9(2)12-6-4-5-11-7-10(12)8-13/h9-11,13H,3-8H2,1-2H3 |
| InChIKey | JDDMRDDYLGOOOK-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-butan-2-yl-1,4-diazepan-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-butan-2-yl-1,4-diazepan-2-yl)methanol?
The IUPAC name of (1-butan-2-yl-1,4-diazepan-2-yl)methanol (CID 82241022) is (1-butan-2-yl-1,4-diazepan-2-yl)methanol.
What is the SMILES notation for (1-butan-2-yl-1,4-diazepan-2-yl)methanol?
The canonical SMILES for (1-butan-2-yl-1,4-diazepan-2-yl)methanol is CCC(C)N1CCCNCC1CO.
What is the InChIKey of (1-butan-2-yl-1,4-diazepan-2-yl)methanol?
The InChIKey is JDDMRDDYLGOOOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O/c1-3-9(2)12-6-4-5-11-7-10(12)8-13/h9-11,13H,3-8H2,1-2H3.
What are the key properties of (1-butan-2-yl-1,4-diazepan-2-yl)methanol?
(1-butan-2-yl-1,4-diazepan-2-yl)methanol has a molecular weight of 186.30 g/mol, XLogP of 0.44, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-butan-2-yl-1,4-diazepan-2-yl)methanol is sourced from PubChem (CID 82241022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).