About 2-(aminomethyl)-N,N-dimethylquinolin-8-amine
2-(aminomethyl)-N,N-dimethylquinolin-8-amine (PubChem CID 82241300) has the molecular formula C12H15N3
and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-(aminomethyl)-N,N-dimethylquinolin-8-amine.
Molecular Properties
| Compound Name | 2-(aminomethyl)-N,N-dimethylquinolin-8-amine |
| PubChem CID | 82241300 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 2-(aminomethyl)-N,N-dimethylquinolin-8-amine |
| SMILES | CN(C)c1cccc2ccc(CN)nc12 |
| InChI | InChI=1S/C12H15N3/c1-15(2)11-5-3-4-9-6-7-10(8-13)14-12(9)11/h3-7H,8,13H2,1-2H3 |
| InChIKey | NBTPHGLXMIOFCD-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(aminomethyl)-N,N-dimethylquinolin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-N,N-dimethylquinolin-8-amine?
The IUPAC name of 2-(aminomethyl)-N,N-dimethylquinolin-8-amine (CID 82241300) is 2-(aminomethyl)-N,N-dimethylquinolin-8-amine.
What is the SMILES notation for 2-(aminomethyl)-N,N-dimethylquinolin-8-amine?
The canonical SMILES for 2-(aminomethyl)-N,N-dimethylquinolin-8-amine is CN(C)c1cccc2ccc(CN)nc12.
What is the InChIKey of 2-(aminomethyl)-N,N-dimethylquinolin-8-amine?
The InChIKey is NBTPHGLXMIOFCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3/c1-15(2)11-5-3-4-9-6-7-10(8-13)14-12(9)11/h3-7H,8,13H2,1-2H3.
What are the key properties of 2-(aminomethyl)-N,N-dimethylquinolin-8-amine?
2-(aminomethyl)-N,N-dimethylquinolin-8-amine has a molecular weight of 201.27 g/mol, XLogP of 1.76, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-N,N-dimethylquinolin-8-amine is sourced from PubChem (CID 82241300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).