C13H20N2 — CID 82241404
1,3,3,9-tetramethyl-4,5-dihydro-2H-1,4-benzodiazepine (PubChem CID 82241404) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 1,3,3,9-tetramethyl-4,5-dihydro-2H-1,4-benzodiazepine.
| Compound Name | 1,3,3,9-tetramethyl-4,5-dihydro-2H-1,4-benzodiazepine |
|---|---|
| PubChem CID | 82241404 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 1,3,3,9-tetramethyl-4,5-dihydro-2H-1,4-benzodiazepine |
| SMILES | Cc1cccc2c1N(C)CC(C)(C)NC2 |
| InChI | InChI=1S/C13H20N2/c1-10-6-5-7-11-8-14-13(2,3)9-15(4)12(10)11/h5-7,14H,8-9H2,1-4H3 |
| InChIKey | ASUUDMNVQYCMHA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |