About (4Z)-4-hydroxyimino-8,9-dimethyl-2,3-dihydro-1-benzoxepin-5-one
(4Z)-4-hydroxyimino-8,9-dimethyl-2,3-dihydro-1-benzoxepin-5-one (PubChem CID 82242049) has the molecular formula C12H13NO3
and a molecular weight of 219.24 g/mol. Its IUPAC name is (4Z)-4-hydroxyimino-8,9-dimethyl-2,3-dihydro-1-benzoxepin-5-one.
Molecular Properties
| Compound Name | (4Z)-4-hydroxyimino-8,9-dimethyl-2,3-dihydro-1-benzoxepin-5-one |
| PubChem CID | 82242049 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | (4Z)-4-hydroxyimino-8,9-dimethyl-2,3-dihydro-1-benzoxepin-5-one |
| SMILES | Cc1ccc2c(c1C)OCC/C(=N/O)C2=O |
| InChI | InChI=1S/C12H13NO3/c1-7-3-4-9-11(14)10(13-15)5-6-16-12(9)8(7)2/h3-4,15H,5-6H2,1-2H3/b13-10- |
| InChIKey | DHRGUYWPUYMEFW-RAXLEYEMSA-N |
| XLogP | 2.10 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-4-hydroxyimino-8,9-dimethyl-2,3-dihydro-1-benzoxepin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-hydroxyimino-8,9-dimethyl-2,3-dihydro-1-benzoxepin-5-one?
The IUPAC name of (4Z)-4-hydroxyimino-8,9-dimethyl-2,3-dihydro-1-benzoxepin-5-one (CID 82242049) is (4Z)-4-hydroxyimino-8,9-dimethyl-2,3-dihydro-1-benzoxepin-5-one.
What is the SMILES notation for (4Z)-4-hydroxyimino-8,9-dimethyl-2,3-dihydro-1-benzoxepin-5-one?
The canonical SMILES for (4Z)-4-hydroxyimino-8,9-dimethyl-2,3-dihydro-1-benzoxepin-5-one is Cc1ccc2c(c1C)OCC/C(=N/O)C2=O.
What is the InChIKey of (4Z)-4-hydroxyimino-8,9-dimethyl-2,3-dihydro-1-benzoxepin-5-one?
The InChIKey is DHRGUYWPUYMEFW-RAXLEYEMSA-N. The full InChI is InChI=1S/C12H13NO3/c1-7-3-4-9-11(14)10(13-15)5-6-16-12(9)8(7)2/h3-4,15H,5-6H2,1-2H3/b13-10-.
What are the key properties of (4Z)-4-hydroxyimino-8,9-dimethyl-2,3-dihydro-1-benzoxepin-5-one?
(4Z)-4-hydroxyimino-8,9-dimethyl-2,3-dihydro-1-benzoxepin-5-one has a molecular weight of 219.24 g/mol, XLogP of 2.10, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-hydroxyimino-8,9-dimethyl-2,3-dihydro-1-benzoxepin-5-one is sourced from PubChem (CID 82242049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).