C12H15FN2O — CID 82242296
2-(2-ethoxy-6-fluorophenyl)-1,4,5,6-tetrahydropyrimidine (PubChem CID 82242296) has the molecular formula C12H15FN2O and a molecular weight of 222.26 g/mol. Its IUPAC name is 2-(2-ethoxy-6-fluorophenyl)-1,4,5,6-tetrahydropyrimidine.
| Compound Name | 2-(2-ethoxy-6-fluorophenyl)-1,4,5,6-tetrahydropyrimidine |
|---|---|
| PubChem CID | 82242296 |
| Molecular Formula | C12H15FN2O |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 2-(2-ethoxy-6-fluorophenyl)-1,4,5,6-tetrahydropyrimidine |
| SMILES | CCOc1cccc(F)c1C1=NCCCN1 |
| InChI | InChI=1S/C12H15FN2O/c1-2-16-10-6-3-5-9(13)11(10)12-14-7-4-8-15-12/h3,5-6H,2,4,7-8H2,1H3,(H,14,15) |
| InChIKey | XZEYXAMTGWTVCP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |