C11H16N2OS — CID 82242378
(5-methyl-1,4-diazepan-1-yl)-thiophen-2-ylmethanone (PubChem CID 82242378) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is (5-methyl-1,4-diazepan-1-yl)-thiophen-2-ylmethanone.
| Compound Name | (5-methyl-1,4-diazepan-1-yl)-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 82242378 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (5-methyl-1,4-diazepan-1-yl)-thiophen-2-ylmethanone |
| SMILES | CC1CCN(C(=O)c2cccs2)CCN1 |
| InChI | InChI=1S/C11H16N2OS/c1-9-4-6-13(7-5-12-9)11(14)10-3-2-8-15-10/h2-3,8-9,12H,4-7H2,1H3 |
| InChIKey | OAQBGHJZEVBHFN-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |