C12H13ClO2 — CID 82242395
2-chloro-1-(2,3,4,5-tetrahydro-1-benzoxepin-7-yl)ethanone (PubChem CID 82242395) has the molecular formula C12H13ClO2 and a molecular weight of 224.69 g/mol. Its IUPAC name is 2-chloro-1-(2,3,4,5-tetrahydro-1-benzoxepin-7-yl)ethanone.
| Compound Name | 2-chloro-1-(2,3,4,5-tetrahydro-1-benzoxepin-7-yl)ethanone |
|---|---|
| PubChem CID | 82242395 |
| Molecular Formula | C12H13ClO2 |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 2-chloro-1-(2,3,4,5-tetrahydro-1-benzoxepin-7-yl)ethanone |
| SMILES | O=C(CCl)c1ccc2c(c1)CCCCO2 |
| InChI | InChI=1S/C12H13ClO2/c13-8-11(14)9-4-5-12-10(7-9)3-1-2-6-15-12/h4-5,7H,1-3,6,8H2 |
| InChIKey | XOZRQBRQGVSIFH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|