About 1-(5,5-dimethyl-2-propan-2-ylpiperazin-1-yl)-2,2-dimethylpropan-1-one
1-(5,5-dimethyl-2-propan-2-ylpiperazin-1-yl)-2,2-dimethylpropan-1-one (PubChem CID 82243727) has the molecular formula C14H28N2O
and a molecular weight of 240.39 g/mol. Its IUPAC name is 1-(5,5-dimethyl-2-propan-2-ylpiperazin-1-yl)-2,2-dimethylpropan-1-one.
Molecular Properties
| Compound Name | 1-(5,5-dimethyl-2-propan-2-ylpiperazin-1-yl)-2,2-dimethylpropan-1-one |
| PubChem CID | 82243727 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | 1-(5,5-dimethyl-2-propan-2-ylpiperazin-1-yl)-2,2-dimethylpropan-1-one |
| SMILES | CC(C)C1CNC(C)(C)CN1C(=O)C(C)(C)C |
| InChI | InChI=1S/C14H28N2O/c1-10(2)11-8-15-14(6,7)9-16(11)12(17)13(3,4)5/h10-11,15H,8-9H2,1-7H3 |
| InChIKey | GQORQRGPIVSEBE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(5,5-dimethyl-2-propan-2-ylpiperazin-1-yl)-2,2-dimethylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5,5-dimethyl-2-propan-2-ylpiperazin-1-yl)-2,2-dimethylpropan-1-one?
The IUPAC name of 1-(5,5-dimethyl-2-propan-2-ylpiperazin-1-yl)-2,2-dimethylpropan-1-one (CID 82243727) is 1-(5,5-dimethyl-2-propan-2-ylpiperazin-1-yl)-2,2-dimethylpropan-1-one.
What is the SMILES notation for 1-(5,5-dimethyl-2-propan-2-ylpiperazin-1-yl)-2,2-dimethylpropan-1-one?
The canonical SMILES for 1-(5,5-dimethyl-2-propan-2-ylpiperazin-1-yl)-2,2-dimethylpropan-1-one is CC(C)C1CNC(C)(C)CN1C(=O)C(C)(C)C.
What is the InChIKey of 1-(5,5-dimethyl-2-propan-2-ylpiperazin-1-yl)-2,2-dimethylpropan-1-one?
The InChIKey is GQORQRGPIVSEBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2O/c1-10(2)11-8-15-14(6,7)9-16(11)12(17)13(3,4)5/h10-11,15H,8-9H2,1-7H3.
What are the key properties of 1-(5,5-dimethyl-2-propan-2-ylpiperazin-1-yl)-2,2-dimethylpropan-1-one?
1-(5,5-dimethyl-2-propan-2-ylpiperazin-1-yl)-2,2-dimethylpropan-1-one has a molecular weight of 240.39 g/mol, XLogP of 2.27, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5,5-dimethyl-2-propan-2-ylpiperazin-1-yl)-2,2-dimethylpropan-1-one is sourced from PubChem (CID 82243727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).