About [4-(2-morpholin-4-ylethyl)-1,4-diazepan-2-yl]methanol
[4-(2-morpholin-4-ylethyl)-1,4-diazepan-2-yl]methanol (PubChem CID 82243970) has the molecular formula C12H25N3O2
and a molecular weight of 243.35 g/mol. Its IUPAC name is [4-(2-morpholin-4-ylethyl)-1,4-diazepan-2-yl]methanol.
Molecular Properties
| Compound Name | [4-(2-morpholin-4-ylethyl)-1,4-diazepan-2-yl]methanol |
| PubChem CID | 82243970 |
| Molecular Formula | C12H25N3O2 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.19 |
| IUPAC Name | [4-(2-morpholin-4-ylethyl)-1,4-diazepan-2-yl]methanol |
| SMILES | OCC1CN(CCN2CCOCC2)CCCN1 |
| InChI | InChI=1S/C12H25N3O2/c16-11-12-10-15(3-1-2-13-12)5-4-14-6-8-17-9-7-14/h12-13,16H,1-11H2 |
| InChIKey | LERYVPUCHKBGCP-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 47.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-(2-morpholin-4-ylethyl)-1,4-diazepan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-morpholin-4-ylethyl)-1,4-diazepan-2-yl]methanol?
The IUPAC name of [4-(2-morpholin-4-ylethyl)-1,4-diazepan-2-yl]methanol (CID 82243970) is [4-(2-morpholin-4-ylethyl)-1,4-diazepan-2-yl]methanol.
What is the SMILES notation for [4-(2-morpholin-4-ylethyl)-1,4-diazepan-2-yl]methanol?
The canonical SMILES for [4-(2-morpholin-4-ylethyl)-1,4-diazepan-2-yl]methanol is OCC1CN(CCN2CCOCC2)CCCN1.
What is the InChIKey of [4-(2-morpholin-4-ylethyl)-1,4-diazepan-2-yl]methanol?
The InChIKey is LERYVPUCHKBGCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N3O2/c16-11-12-10-15(3-1-2-13-12)5-4-14-6-8-17-9-7-14/h12-13,16H,1-11H2.
What are the key properties of [4-(2-morpholin-4-ylethyl)-1,4-diazepan-2-yl]methanol?
[4-(2-morpholin-4-ylethyl)-1,4-diazepan-2-yl]methanol has a molecular weight of 243.35 g/mol, XLogP of -1.03, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-morpholin-4-ylethyl)-1,4-diazepan-2-yl]methanol is sourced from PubChem (CID 82243970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).