C13H16F2N2O — CID 82245250
(3,4-difluorophenyl)-(7-methyl-1,4-diazepan-1-yl)methanone (PubChem CID 82245250) has the molecular formula C13H16F2N2O and a molecular weight of 254.28 g/mol. Its IUPAC name is (3,4-difluorophenyl)-(7-methyl-1,4-diazepan-1-yl)methanone.
| Compound Name | (3,4-difluorophenyl)-(7-methyl-1,4-diazepan-1-yl)methanone |
|---|---|
| PubChem CID | 82245250 |
| Molecular Formula | C13H16F2N2O |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | (3,4-difluorophenyl)-(7-methyl-1,4-diazepan-1-yl)methanone |
| SMILES | CC1CCNCCN1C(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H16F2N2O/c1-9-4-5-16-6-7-17(9)13(18)10-2-3-11(14)12(15)8-10/h2-3,8-9,16H,4-7H2,1H3 |
| InChIKey | UOCBOYZSUFAVQT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |