C17H28N2 — CID 82246093
3,3,9-trimethyl-1-pentyl-4,5-dihydro-2H-1,4-benzodiazepine (PubChem CID 82246093) has the molecular formula C17H28N2 and a molecular weight of 260.42 g/mol. Its IUPAC name is 3,3,9-trimethyl-1-pentyl-4,5-dihydro-2H-1,4-benzodiazepine.
| Compound Name | 3,3,9-trimethyl-1-pentyl-4,5-dihydro-2H-1,4-benzodiazepine |
|---|---|
| PubChem CID | 82246093 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | 3,3,9-trimethyl-1-pentyl-4,5-dihydro-2H-1,4-benzodiazepine |
| SMILES | CCCCCN1CC(C)(C)NCc2cccc(C)c21 |
| InChI | InChI=1S/C17H28N2/c1-5-6-7-11-19-13-17(3,4)18-12-15-10-8-9-14(2)16(15)19/h8-10,18H,5-7,11-13H2,1-4H3 |
| InChIKey | GMXMBKVMJJJCER-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|