C16H27N3 — CID 82246275
3-(3,7-dimethyl-2,3,4,5-tetrahydro-1,4-benzodiazepin-1-yl)-N,N-dimethylpropan-1-amine (PubChem CID 82246275) has the molecular formula C16H27N3 and a molecular weight of 261.41 g/mol. Its IUPAC name is 3-(3,7-dimethyl-2,3,4,5-tetrahydro-1,4-benzodiazepin-1-yl)-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(3,7-dimethyl-2,3,4,5-tetrahydro-1,4-benzodiazepin-1-yl)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 82246275 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | 3-(3,7-dimethyl-2,3,4,5-tetrahydro-1,4-benzodiazepin-1-yl)-N,N-dimethylpropan-1-amine |
| SMILES | Cc1ccc2c(c1)CNC(C)CN2CCCN(C)C |
| InChI | InChI=1S/C16H27N3/c1-13-6-7-16-15(10-13)11-17-14(2)12-19(16)9-5-8-18(3)4/h6-7,10,14,17H,5,8-9,11-12H2,1-4H3 |
| InChIKey | BGFVLWLYTVYGNW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |