About 3-(6,7-dichloroquinolin-2-yl)-2-methylpropanenitrile
3-(6,7-dichloroquinolin-2-yl)-2-methylpropanenitrile (PubChem CID 82246749) has the molecular formula C13H10Cl2N2
and a molecular weight of 265.14 g/mol. Its IUPAC name is 3-(6,7-dichloroquinolin-2-yl)-2-methylpropanenitrile.
Molecular Properties
| Compound Name | 3-(6,7-dichloroquinolin-2-yl)-2-methylpropanenitrile |
| PubChem CID | 82246749 |
| Molecular Formula | C13H10Cl2N2 |
| Molecular Weight | 265.14 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 3-(6,7-dichloroquinolin-2-yl)-2-methylpropanenitrile |
| SMILES | CC(C#N)Cc1ccc2cc(Cl)c(Cl)cc2n1 |
| InChI | InChI=1S/C13H10Cl2N2/c1-8(7-16)4-10-3-2-9-5-11(14)12(15)6-13(9)17-10/h2-3,5-6,8H,4H2,1H3 |
| InChIKey | LAVGRJNITIZDEF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.14 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(6,7-dichloroquinolin-2-yl)-2-methylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6,7-dichloroquinolin-2-yl)-2-methylpropanenitrile?
The IUPAC name of 3-(6,7-dichloroquinolin-2-yl)-2-methylpropanenitrile (CID 82246749) is 3-(6,7-dichloroquinolin-2-yl)-2-methylpropanenitrile.
What is the SMILES notation for 3-(6,7-dichloroquinolin-2-yl)-2-methylpropanenitrile?
The canonical SMILES for 3-(6,7-dichloroquinolin-2-yl)-2-methylpropanenitrile is CC(C#N)Cc1ccc2cc(Cl)c(Cl)cc2n1.
What is the InChIKey of 3-(6,7-dichloroquinolin-2-yl)-2-methylpropanenitrile?
The InChIKey is LAVGRJNITIZDEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10Cl2N2/c1-8(7-16)4-10-3-2-9-5-11(14)12(15)6-13(9)17-10/h2-3,5-6,8H,4H2,1H3.
What are the key properties of 3-(6,7-dichloroquinolin-2-yl)-2-methylpropanenitrile?
3-(6,7-dichloroquinolin-2-yl)-2-methylpropanenitrile has a molecular weight of 265.14 g/mol, XLogP of 4.24, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6,7-dichloroquinolin-2-yl)-2-methylpropanenitrile is sourced from PubChem (CID 82246749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).